C12H15BrN2O3 — CID 115179465
2-amino-3-[2-(5-bromo-2-methylphenyl)ethylamino]-3-oxopropanoic acid (PubChem CID 115179465) has the molecular formula C12H15BrN2O3 and a molecular weight of 315.17 g/mol. Its IUPAC name is 2-amino-3-[2-(5-bromo-2-methylphenyl)ethylamino]-3-oxopropanoic acid.
| Compound Name | 2-amino-3-[2-(5-bromo-2-methylphenyl)ethylamino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 115179465 |
| Molecular Formula | C12H15BrN2O3 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 2-amino-3-[2-(5-bromo-2-methylphenyl)ethylamino]-3-oxopropanoic acid |
| SMILES | Cc1ccc(Br)cc1CCNC(=O)C(N)C(=O)O |
| InChI | InChI=1S/C12H15BrN2O3/c1-7-2-3-9(13)6-8(7)4-5-15-11(16)10(14)12(17)18/h2-3,6,10H,4-5,14H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | RRVWTELOCWVHTE-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|