C14H18BrNO2 — CID 115176955
N-[2-(5-bromo-2-methylphenyl)ethyl]-4-oxopentanamide (PubChem CID 115176955) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is N-[2-(5-bromo-2-methylphenyl)ethyl]-4-oxopentanamide.
| Compound Name | N-[2-(5-bromo-2-methylphenyl)ethyl]-4-oxopentanamide |
|---|---|
| PubChem CID | 115176955 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | N-[2-(5-bromo-2-methylphenyl)ethyl]-4-oxopentanamide |
| SMILES | CC(=O)CCC(=O)NCCc1cc(Br)ccc1C |
| InChI | InChI=1S/C14H18BrNO2/c1-10-3-5-13(15)9-12(10)7-8-16-14(18)6-4-11(2)17/h3,5,9H,4,6-8H2,1-2H3,(H,16,18) |
| InChIKey | NHAGYAWJADRIGG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |