C11H14BrNO — CID 175640047
3-(5-bromo-2-methylphenyl)-N-methylpropanamide (PubChem CID 175640047) has the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. Its IUPAC name is 3-(5-bromo-2-methylphenyl)-N-methylpropanamide.
| Compound Name | 3-(5-bromo-2-methylphenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 175640047 |
| Molecular Formula | C11H14BrNO |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 3-(5-bromo-2-methylphenyl)-N-methylpropanamide |
| SMILES | CNC(=O)CCc1cc(Br)ccc1C |
| InChI | InChI=1S/C11H14BrNO/c1-8-3-5-10(12)7-9(8)4-6-11(14)13-2/h3,5,7H,4,6H2,1-2H3,(H,13,14) |
| InChIKey | DEQIVZGHJVJNSM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |