C12H14BrNO2 — CID 115176428
N-[(5-bromo-2-methylphenyl)methyl]-3-oxobutanamide (PubChem CID 115176428) has the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. Its IUPAC name is N-[(5-bromo-2-methylphenyl)methyl]-3-oxobutanamide.
| Compound Name | N-[(5-bromo-2-methylphenyl)methyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 115176428 |
| Molecular Formula | C12H14BrNO2 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | N-[(5-bromo-2-methylphenyl)methyl]-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)NCc1cc(Br)ccc1C |
| InChI | InChI=1S/C12H14BrNO2/c1-8-3-4-11(13)6-10(8)7-14-12(16)5-9(2)15/h3-4,6H,5,7H2,1-2H3,(H,14,16) |
| InChIKey | YEGJIPHTTPSMBY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|