C12H14BrNO — CID 95971045
N-[(5-bromo-2-methylphenyl)methyl]cyclopropanecarboxamide (PubChem CID 95971045) has the molecular formula C12H14BrNO and a molecular weight of 268.15 g/mol. Its IUPAC name is N-[(5-bromo-2-methylphenyl)methyl]cyclopropanecarboxamide.
| Compound Name | N-[(5-bromo-2-methylphenyl)methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 95971045 |
| Molecular Formula | C12H14BrNO |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | N-[(5-bromo-2-methylphenyl)methyl]cyclopropanecarboxamide |
| SMILES | Cc1ccc(Br)cc1CNC(=O)C1CC1 |
| InChI | InChI=1S/C12H14BrNO/c1-8-2-5-11(13)6-10(8)7-14-12(15)9-3-4-9/h2,5-6,9H,3-4,7H2,1H3,(H,14,15) |
| InChIKey | XKGQYPFWMHETKE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |