C12H11BrF3NO — CID 67195679
N-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]cyclopropanecarboxamide (PubChem CID 67195679) has the molecular formula C12H11BrF3NO and a molecular weight of 322.12 g/mol. Its IUPAC name is N-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]cyclopropanecarboxamide.
| Compound Name | N-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 67195679 |
| Molecular Formula | C12H11BrF3NO |
| Molecular Weight | 322.12 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | N-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]cyclopropanecarboxamide |
| SMILES | O=C(NCc1ccc(Br)cc1C(F)(F)F)C1CC1 |
| InChI | InChI=1S/C12H11BrF3NO/c13-9-4-3-8(10(5-9)12(14,15)16)6-17-11(18)7-1-2-7/h3-5,7H,1-2,6H2,(H,17,18) |
| InChIKey | BKJLJDYGFBQTML-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.12 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |