C20H27F3N2O3 — CID 67331195
tert-butyl-[4-[[2-(trifluoromethyl)phenyl]methylcarbamoyl]cyclohexyl]carbamic acid (PubChem CID 67331195) has the molecular formula C20H27F3N2O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is tert-butyl-[4-[[2-(trifluoromethyl)phenyl]methylcarbamoyl]cyclohexyl]carbamic acid.
| Compound Name | tert-butyl-[4-[[2-(trifluoromethyl)phenyl]methylcarbamoyl]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 67331195 |
| Molecular Formula | C20H27F3N2O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | tert-butyl-[4-[[2-(trifluoromethyl)phenyl]methylcarbamoyl]cyclohexyl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1CCC(C(=O)NCc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H27F3N2O3/c1-19(2,3)25(18(27)28)15-10-8-13(9-11-15)17(26)24-12-14-6-4-5-7-16(14)20(21,22)23/h4-7,13,15H,8-12H2,1-3H3,(H,24,26)(H,27,28) |
| InChIKey | JNRBDGOOFZZBQS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |