C10H10BrF3N2O2 — CID 71967369
1-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]-3-methoxyurea (PubChem CID 71967369) has the molecular formula C10H10BrF3N2O2 and a molecular weight of 327.10 g/mol. Its IUPAC name is 1-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]-3-methoxyurea.
| Compound Name | 1-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]-3-methoxyurea |
|---|---|
| PubChem CID | 71967369 |
| Molecular Formula | C10H10BrF3N2O2 |
| Molecular Weight | 327.10 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 1-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]-3-methoxyurea |
| SMILES | CONC(=O)NCc1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C10H10BrF3N2O2/c1-18-16-9(17)15-5-6-2-3-7(11)4-8(6)10(12,13)14/h2-4H,5H2,1H3,(H2,15,16,17) |
| InChIKey | OSISQRWZYHJYHK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.10 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|