C11H13BrF3N — CID 107332749
N-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]propan-1-amine (PubChem CID 107332749) has the molecular formula C11H13BrF3N and a molecular weight of 296.13 g/mol. Its IUPAC name is N-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]propan-1-amine.
| Compound Name | N-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107332749 |
| Molecular Formula | C11H13BrF3N |
| Molecular Weight | 296.13 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | N-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C11H13BrF3N/c1-2-5-16-7-8-3-4-9(12)6-10(8)11(13,14)15/h3-4,6,16H,2,5,7H2,1H3 |
| InChIKey | PNGSZYNHUWFTGH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.13 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|