C17H25F3N2O2 — CID 170306134
tert-butyl-[[4-(propylaminomethyl)-3-(trifluoromethyl)phenyl]methyl]carbamic acid (PubChem CID 170306134) has the molecular formula C17H25F3N2O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is tert-butyl-[[4-(propylaminomethyl)-3-(trifluoromethyl)phenyl]methyl]carbamic acid.
| Compound Name | tert-butyl-[[4-(propylaminomethyl)-3-(trifluoromethyl)phenyl]methyl]carbamic acid |
|---|---|
| PubChem CID | 170306134 |
| Molecular Formula | C17H25F3N2O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | tert-butyl-[[4-(propylaminomethyl)-3-(trifluoromethyl)phenyl]methyl]carbamic acid |
| SMILES | CCCNCc1ccc(CN(C(=O)O)C(C)(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C17H25F3N2O2/c1-5-8-21-10-13-7-6-12(9-14(13)17(18,19)20)11-22(15(23)24)16(2,3)4/h6-7,9,21H,5,8,10-11H2,1-4H3,(H,23,24) |
| InChIKey | SRXIRKTZEXFAND-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|