C11H12F3NO2 — CID 68848835
4-[(dimethylamino)methyl]-3-(trifluoromethyl)benzoic acid (PubChem CID 68848835) has the molecular formula C11H12F3NO2 and a molecular weight of 247.22 g/mol. Its IUPAC name is 4-[(dimethylamino)methyl]-3-(trifluoromethyl)benzoic acid.
| Compound Name | 4-[(dimethylamino)methyl]-3-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 68848835 |
| Molecular Formula | C11H12F3NO2 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 4-[(dimethylamino)methyl]-3-(trifluoromethyl)benzoic acid |
| SMILES | CN(C)Cc1ccc(C(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C11H12F3NO2/c1-15(2)6-8-4-3-7(10(16)17)5-9(8)11(12,13)14/h3-5H,6H2,1-2H3,(H,16,17) |
| InChIKey | OWRXEUBBXZUBNI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |