C16H12F6N2O4 — CID 90656922
4-amino-3-(trifluoromethyl)benzoic acid (PubChem CID 90656922) has the molecular formula C16H12F6N2O4 and a molecular weight of 410.27 g/mol. Its IUPAC name is 4-amino-3-(trifluoromethyl)benzoic acid.
| Compound Name | 4-amino-3-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 90656922 |
| Molecular Formula | C16H12F6N2O4 |
| Molecular Weight | 410.27 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 4-amino-3-(trifluoromethyl)benzoic acid |
| SMILES | Nc1ccc(C(=O)O)cc1C(F)(F)F.Nc1ccc(C(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/2C8H6F3NO2/c2*9-8(10,11)5-3-4(7(13)14)1-2-6(5)12/h2*1-3H,12H2,(H,13,14) |
| InChIKey | UIJAWSQWQHQKME-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.27 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|