C11H10F6N2O — CID 62161986
4-amino-N-methyl-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)benzamide (PubChem CID 62161986) has the molecular formula C11H10F6N2O and a molecular weight of 300.20 g/mol. Its IUPAC name is 4-amino-N-methyl-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)benzamide.
| Compound Name | 4-amino-N-methyl-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 62161986 |
| Molecular Formula | C11H10F6N2O |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 4-amino-N-methyl-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)benzamide |
| SMILES | CN(CC(F)(F)F)C(=O)c1ccc(N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H10F6N2O/c1-19(5-10(12,13)14)9(20)6-2-3-8(18)7(4-6)11(15,16)17/h2-4H,5,18H2,1H3 |
| InChIKey | AXOROBRVEVTHCR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|