C10H8F6N2O — CID 62153422
4-amino-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)benzamide (PubChem CID 62153422) has the molecular formula C10H8F6N2O and a molecular weight of 286.18 g/mol. Its IUPAC name is 4-amino-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)benzamide.
| Compound Name | 4-amino-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 62153422 |
| Molecular Formula | C10H8F6N2O |
| Molecular Weight | 286.18 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 4-amino-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)benzamide |
| SMILES | Nc1ccc(C(=O)NCC(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C10H8F6N2O/c11-9(12,13)4-18-8(19)5-1-2-7(17)6(3-5)10(14,15)16/h1-3H,4,17H2,(H,18,19) |
| InChIKey | QOOKGTASSAWKAR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.18 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|