C9H7BrF3NO2 — CID 103830485
4-bromo-3-hydroxy-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 103830485) has the molecular formula C9H7BrF3NO2 and a molecular weight of 298.06 g/mol. Its IUPAC name is 4-bromo-3-hydroxy-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-bromo-3-hydroxy-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 103830485 |
| Molecular Formula | C9H7BrF3NO2 |
| Molecular Weight | 298.06 g/mol |
| Exact Mass | 296.96 |
| IUPAC Name | 4-bromo-3-hydroxy-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(NCC(F)(F)F)c1ccc(Br)c(O)c1 |
| InChI | InChI=1S/C9H7BrF3NO2/c10-6-2-1-5(3-7(6)15)8(16)14-4-9(11,12)13/h1-3,15H,4H2,(H,14,16) |
| InChIKey | XVAZUXGATYSHEP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.06 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |