C13H9BrF3NO — CID 115283099
6-bromo-N-(2,2,2-trifluoroethyl)naphthalene-2-carboxamide (PubChem CID 115283099) has the molecular formula C13H9BrF3NO and a molecular weight of 332.12 g/mol. Its IUPAC name is 6-bromo-N-(2,2,2-trifluoroethyl)naphthalene-2-carboxamide.
| Compound Name | 6-bromo-N-(2,2,2-trifluoroethyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 115283099 |
| Molecular Formula | C13H9BrF3NO |
| Molecular Weight | 332.12 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 6-bromo-N-(2,2,2-trifluoroethyl)naphthalene-2-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C13H9BrF3NO/c14-11-4-3-8-5-10(2-1-9(8)6-11)12(19)18-7-13(15,16)17/h1-6H,7H2,(H,18,19) |
| InChIKey | NPDKHTAQIOXESK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.12 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |