C12H9BrN2O2 — CID 115354574
6-bromo-N-carbamoylnaphthalene-2-carboxamide (PubChem CID 115354574) has the molecular formula C12H9BrN2O2 and a molecular weight of 293.12 g/mol. Its IUPAC name is 6-bromo-N-carbamoylnaphthalene-2-carboxamide.
| Compound Name | 6-bromo-N-carbamoylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 115354574 |
| Molecular Formula | C12H9BrN2O2 |
| Molecular Weight | 293.12 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | 6-bromo-N-carbamoylnaphthalene-2-carboxamide |
| SMILES | NC(=O)NC(=O)c1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C12H9BrN2O2/c13-10-4-3-7-5-9(2-1-8(7)6-10)11(16)15-12(14)17/h1-6H,(H3,14,15,16,17) |
| InChIKey | VZMCOTFGEIRDFL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.12 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |