C8H6Br2N2O2 — CID 114375953
2,5-dibromo-N-carbamoylbenzamide (PubChem CID 114375953) has the molecular formula C8H6Br2N2O2 and a molecular weight of 321.96 g/mol. Its IUPAC name is 2,5-dibromo-N-carbamoylbenzamide.
| Compound Name | 2,5-dibromo-N-carbamoylbenzamide |
|---|---|
| PubChem CID | 114375953 |
| Molecular Formula | C8H6Br2N2O2 |
| Molecular Weight | 321.96 g/mol |
| Exact Mass | 319.88 |
| IUPAC Name | 2,5-dibromo-N-carbamoylbenzamide |
| SMILES | NC(=O)NC(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C8H6Br2N2O2/c9-4-1-2-6(10)5(3-4)7(13)12-8(11)14/h1-3H,(H3,11,12,13,14) |
| InChIKey | QSZVUKGHCMJYHG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.96 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |