C10H12Br2N2O — CID 114368344
N-(3-aminopropyl)-2,5-dibromobenzamide (PubChem CID 114368344) has the molecular formula C10H12Br2N2O and a molecular weight of 336.03 g/mol. Its IUPAC name is N-(3-aminopropyl)-2,5-dibromobenzamide.
| Compound Name | N-(3-aminopropyl)-2,5-dibromobenzamide |
|---|---|
| PubChem CID | 114368344 |
| Molecular Formula | C10H12Br2N2O |
| Molecular Weight | 336.03 g/mol |
| Exact Mass | 333.93 |
| IUPAC Name | N-(3-aminopropyl)-2,5-dibromobenzamide |
| SMILES | NCCCNC(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C10H12Br2N2O/c11-7-2-3-9(12)8(6-7)10(15)14-5-1-4-13/h2-3,6H,1,4-5,13H2,(H,14,15) |
| InChIKey | LEZQBGZUEYJQPP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.03 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|