C11H14Br2N2O — CID 114374303
2,5-dibromo-N-[2-(ethylamino)ethyl]benzamide (PubChem CID 114374303) has the molecular formula C11H14Br2N2O and a molecular weight of 350.05 g/mol. Its IUPAC name is 2,5-dibromo-N-[2-(ethylamino)ethyl]benzamide.
| Compound Name | 2,5-dibromo-N-[2-(ethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 114374303 |
| Molecular Formula | C11H14Br2N2O |
| Molecular Weight | 350.05 g/mol |
| Exact Mass | 347.95 |
| IUPAC Name | 2,5-dibromo-N-[2-(ethylamino)ethyl]benzamide |
| SMILES | CCNCCNC(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H14Br2N2O/c1-2-14-5-6-15-11(16)9-7-8(12)3-4-10(9)13/h3-4,7,14H,2,5-6H2,1H3,(H,15,16) |
| InChIKey | VQLJBOMEXUBNTJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.05 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|