C13H18Br2N2O2 — CID 104920627
2,5-dibromo-N-[2-[2-(dimethylamino)ethoxy]ethyl]benzamide (PubChem CID 104920627) has the molecular formula C13H18Br2N2O2 and a molecular weight of 394.11 g/mol. Its IUPAC name is 2,5-dibromo-N-[2-[2-(dimethylamino)ethoxy]ethyl]benzamide.
| Compound Name | 2,5-dibromo-N-[2-[2-(dimethylamino)ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 104920627 |
| Molecular Formula | C13H18Br2N2O2 |
| Molecular Weight | 394.11 g/mol |
| Exact Mass | 391.97 |
| IUPAC Name | 2,5-dibromo-N-[2-[2-(dimethylamino)ethoxy]ethyl]benzamide |
| SMILES | CN(C)CCOCCNC(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C13H18Br2N2O2/c1-17(2)6-8-19-7-5-16-13(18)11-9-10(14)3-4-12(11)15/h3-4,9H,5-8H2,1-2H3,(H,16,18) |
| InChIKey | AMGMTTGIDBVJRQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.11 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|