C11H14Br2N2O — CID 114368349
2,5-dibromo-N-methyl-N-[2-(methylamino)ethyl]benzamide (PubChem CID 114368349) has the molecular formula C11H14Br2N2O and a molecular weight of 350.05 g/mol. Its IUPAC name is 2,5-dibromo-N-methyl-N-[2-(methylamino)ethyl]benzamide.
| Compound Name | 2,5-dibromo-N-methyl-N-[2-(methylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 114368349 |
| Molecular Formula | C11H14Br2N2O |
| Molecular Weight | 350.05 g/mol |
| Exact Mass | 347.95 |
| IUPAC Name | 2,5-dibromo-N-methyl-N-[2-(methylamino)ethyl]benzamide |
| SMILES | CNCCN(C)C(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H14Br2N2O/c1-14-5-6-15(2)11(16)9-7-8(12)3-4-10(9)13/h3-4,7,14H,5-6H2,1-2H3 |
| InChIKey | VLBRLIJPTKDPII-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.05 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |