C11H12Br3NO — CID 114375651
2,5-dibromo-N-(2-bromopropyl)-N-methylbenzamide (PubChem CID 114375651) has the molecular formula C11H12Br3NO and a molecular weight of 413.94 g/mol. Its IUPAC name is 2,5-dibromo-N-(2-bromopropyl)-N-methylbenzamide.
| Compound Name | 2,5-dibromo-N-(2-bromopropyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 114375651 |
| Molecular Formula | C11H12Br3NO |
| Molecular Weight | 413.94 g/mol |
| Exact Mass | 410.85 |
| IUPAC Name | 2,5-dibromo-N-(2-bromopropyl)-N-methylbenzamide |
| SMILES | CC(Br)CN(C)C(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H12Br3NO/c1-7(12)6-15(2)11(16)9-5-8(13)3-4-10(9)14/h3-5,7H,6H2,1-2H3 |
| InChIKey | RFSFUJOHTAITCR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.94 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|