C17H25Br2NO — CID 114371455
2,5-dibromo-N,N-bis(3-methylbutyl)benzamide (PubChem CID 114371455) has the molecular formula C17H25Br2NO and a molecular weight of 419.20 g/mol. Its IUPAC name is 2,5-dibromo-N,N-bis(3-methylbutyl)benzamide.
| Compound Name | 2,5-dibromo-N,N-bis(3-methylbutyl)benzamide |
|---|---|
| PubChem CID | 114371455 |
| Molecular Formula | C17H25Br2NO |
| Molecular Weight | 419.20 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | 2,5-dibromo-N,N-bis(3-methylbutyl)benzamide |
| SMILES | CC(C)CCN(CCC(C)C)C(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C17H25Br2NO/c1-12(2)7-9-20(10-8-13(3)4)17(21)15-11-14(18)5-6-16(15)19/h5-6,11-13H,7-10H2,1-4H3 |
| InChIKey | XDRZAHRNLKCIHM-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.20 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |