C17H25BrFNO — CID 63525644
4-bromo-2-fluoro-N,N-bis(3-methylbutyl)benzamide (PubChem CID 63525644) has the molecular formula C17H25BrFNO and a molecular weight of 358.30 g/mol. Its IUPAC name is 4-bromo-2-fluoro-N,N-bis(3-methylbutyl)benzamide.
| Compound Name | 4-bromo-2-fluoro-N,N-bis(3-methylbutyl)benzamide |
|---|---|
| PubChem CID | 63525644 |
| Molecular Formula | C17H25BrFNO |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 4-bromo-2-fluoro-N,N-bis(3-methylbutyl)benzamide |
| SMILES | CC(C)CCN(CCC(C)C)C(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C17H25BrFNO/c1-12(2)7-9-20(10-8-13(3)4)17(21)15-6-5-14(18)11-16(15)19/h5-6,11-13H,7-10H2,1-4H3 |
| InChIKey | DQTJOBNFDHRIOZ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |