C17H26BrNOS — CID 107871654
4-bromo-N,N-bis(3-methylbutyl)-2-sulfanylbenzamide (PubChem CID 107871654) has the molecular formula C17H26BrNOS and a molecular weight of 372.37 g/mol. Its IUPAC name is 4-bromo-N,N-bis(3-methylbutyl)-2-sulfanylbenzamide.
| Compound Name | 4-bromo-N,N-bis(3-methylbutyl)-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 107871654 |
| Molecular Formula | C17H26BrNOS |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 4-bromo-N,N-bis(3-methylbutyl)-2-sulfanylbenzamide |
| SMILES | CC(C)CCN(CCC(C)C)C(=O)c1ccc(Br)cc1S |
| InChI | InChI=1S/C17H26BrNOS/c1-12(2)7-9-19(10-8-13(3)4)17(20)15-6-5-14(18)11-16(15)21/h5-6,11-13,21H,7-10H2,1-4H3 |
| InChIKey | VQXVCXZMWHUKOV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|