C15H22BrNO3S — CID 107033845
4-bromo-N,N-bis(2-ethoxyethyl)-2-sulfanylbenzamide (PubChem CID 107033845) has the molecular formula C15H22BrNO3S and a molecular weight of 376.32 g/mol. Its IUPAC name is 4-bromo-N,N-bis(2-ethoxyethyl)-2-sulfanylbenzamide.
| Compound Name | 4-bromo-N,N-bis(2-ethoxyethyl)-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 107033845 |
| Molecular Formula | C15H22BrNO3S |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 4-bromo-N,N-bis(2-ethoxyethyl)-2-sulfanylbenzamide |
| SMILES | CCOCCN(CCOCC)C(=O)c1ccc(Br)cc1S |
| InChI | InChI=1S/C15H22BrNO3S/c1-3-19-9-7-17(8-10-20-4-2)15(18)13-6-5-12(16)11-14(13)21/h5-6,11,21H,3-4,7-10H2,1-2H3 |
| InChIKey | KBBFEADPTZYJII-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|