C15H21BrClNO3 — CID 82960004
5-bromo-2-chloro-N,N-bis(2-ethoxyethyl)benzamide (PubChem CID 82960004) has the molecular formula C15H21BrClNO3 and a molecular weight of 378.69 g/mol. Its IUPAC name is 5-bromo-2-chloro-N,N-bis(2-ethoxyethyl)benzamide.
| Compound Name | 5-bromo-2-chloro-N,N-bis(2-ethoxyethyl)benzamide |
|---|---|
| PubChem CID | 82960004 |
| Molecular Formula | C15H21BrClNO3 |
| Molecular Weight | 378.69 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 5-bromo-2-chloro-N,N-bis(2-ethoxyethyl)benzamide |
| SMILES | CCOCCN(CCOCC)C(=O)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C15H21BrClNO3/c1-3-20-9-7-18(8-10-21-4-2)15(19)13-11-12(16)5-6-14(13)17/h5-6,11H,3-4,7-10H2,1-2H3 |
| InChIKey | VCFIXIMQAGIVTM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.69 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|