C13H16Br2ClNO2 — CID 114263894
2,4-dibromo-N-[2-(2-chloroethoxy)ethyl]-N-ethylbenzamide (PubChem CID 114263894) has the molecular formula C13H16Br2ClNO2 and a molecular weight of 413.54 g/mol. Its IUPAC name is 2,4-dibromo-N-[2-(2-chloroethoxy)ethyl]-N-ethylbenzamide.
| Compound Name | 2,4-dibromo-N-[2-(2-chloroethoxy)ethyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 114263894 |
| Molecular Formula | C13H16Br2ClNO2 |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 410.92 |
| IUPAC Name | 2,4-dibromo-N-[2-(2-chloroethoxy)ethyl]-N-ethylbenzamide |
| SMILES | CCN(CCOCCCl)C(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H16Br2ClNO2/c1-2-17(6-8-19-7-5-16)13(18)11-4-3-10(14)9-12(11)15/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | SSUUAEPUYGNYHS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|