C14H18Br2ClNO — CID 114018643
2,4-dibromo-N-(2-chloroethyl)-N-pentan-3-ylbenzamide (PubChem CID 114018643) has the molecular formula C14H18Br2ClNO and a molecular weight of 411.57 g/mol. Its IUPAC name is 2,4-dibromo-N-(2-chloroethyl)-N-pentan-3-ylbenzamide.
| Compound Name | 2,4-dibromo-N-(2-chloroethyl)-N-pentan-3-ylbenzamide |
|---|---|
| PubChem CID | 114018643 |
| Molecular Formula | C14H18Br2ClNO |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 408.94 |
| IUPAC Name | 2,4-dibromo-N-(2-chloroethyl)-N-pentan-3-ylbenzamide |
| SMILES | CCC(CC)N(CCCl)C(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H18Br2ClNO/c1-3-11(4-2)18(8-7-17)14(19)12-6-5-10(15)9-13(12)16/h5-6,9,11H,3-4,7-8H2,1-2H3 |
| InChIKey | KXJIVIBCFGVPMQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|