C14H18Cl3NO — CID 63395991
2,5-dichloro-N-(2-chloroethyl)-N-pentan-3-ylbenzamide (PubChem CID 63395991) has the molecular formula C14H18Cl3NO and a molecular weight of 322.66 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-chloroethyl)-N-pentan-3-ylbenzamide.
| Compound Name | 2,5-dichloro-N-(2-chloroethyl)-N-pentan-3-ylbenzamide |
|---|---|
| PubChem CID | 63395991 |
| Molecular Formula | C14H18Cl3NO |
| Molecular Weight | 322.66 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 2,5-dichloro-N-(2-chloroethyl)-N-pentan-3-ylbenzamide |
| SMILES | CCC(CC)N(CCCl)C(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H18Cl3NO/c1-3-11(4-2)18(8-7-15)14(19)12-9-10(16)5-6-13(12)17/h5-6,9,11H,3-4,7-8H2,1-2H3 |
| InChIKey | PPFYUQOHERKCLZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.66 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|