C15H21Cl2NO — CID 63398181
N-(2-chloroethyl)-2-(3-chlorophenyl)-N-pentan-3-ylacetamide (PubChem CID 63398181) has the molecular formula C15H21Cl2NO and a molecular weight of 302.24 g/mol. Its IUPAC name is N-(2-chloroethyl)-2-(3-chlorophenyl)-N-pentan-3-ylacetamide.
| Compound Name | N-(2-chloroethyl)-2-(3-chlorophenyl)-N-pentan-3-ylacetamide |
|---|---|
| PubChem CID | 63398181 |
| Molecular Formula | C15H21Cl2NO |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-(2-chloroethyl)-2-(3-chlorophenyl)-N-pentan-3-ylacetamide |
| SMILES | CCC(CC)N(CCCl)C(=O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H21Cl2NO/c1-3-14(4-2)18(9-8-16)15(19)11-12-6-5-7-13(17)10-12/h5-7,10,14H,3-4,8-9,11H2,1-2H3 |
| InChIKey | UWIRFVMSFRSCNU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|