C15H23ClN2O2 — CID 61108278
2-amino-5-chloro-N-(2-methoxyethyl)-N-pentan-3-ylbenzamide (PubChem CID 61108278) has the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. Its IUPAC name is 2-amino-5-chloro-N-(2-methoxyethyl)-N-pentan-3-ylbenzamide.
| Compound Name | 2-amino-5-chloro-N-(2-methoxyethyl)-N-pentan-3-ylbenzamide |
|---|---|
| PubChem CID | 61108278 |
| Molecular Formula | C15H23ClN2O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-amino-5-chloro-N-(2-methoxyethyl)-N-pentan-3-ylbenzamide |
| SMILES | CCC(CC)N(CCOC)C(=O)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C15H23ClN2O2/c1-4-12(5-2)18(8-9-20-3)15(19)13-10-11(16)6-7-14(13)17/h6-7,10,12H,4-5,8-9,17H2,1-3H3 |
| InChIKey | OQICRCWJKRFFEW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|