C12H15Br2NO — CID 103883121
2,4-dibromo-N-butan-2-yl-N-methylbenzamide (PubChem CID 103883121) has the molecular formula C12H15Br2NO and a molecular weight of 349.07 g/mol. Its IUPAC name is 2,4-dibromo-N-butan-2-yl-N-methylbenzamide.
| Compound Name | 2,4-dibromo-N-butan-2-yl-N-methylbenzamide |
|---|---|
| PubChem CID | 103883121 |
| Molecular Formula | C12H15Br2NO |
| Molecular Weight | 349.07 g/mol |
| Exact Mass | 346.95 |
| IUPAC Name | 2,4-dibromo-N-butan-2-yl-N-methylbenzamide |
| SMILES | CCC(C)N(C)C(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H15Br2NO/c1-4-8(2)15(3)12(16)10-6-5-9(13)7-11(10)14/h5-8H,4H2,1-3H3 |
| InChIKey | WIOPQBRNPSJGOT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.07 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |