C12H14Br2N2OS — CID 114018352
N-(4-amino-4-sulfanylidenebutan-2-yl)-2,4-dibromo-N-methylbenzamide (PubChem CID 114018352) has the molecular formula C12H14Br2N2OS and a molecular weight of 394.13 g/mol. Its IUPAC name is N-(4-amino-4-sulfanylidenebutan-2-yl)-2,4-dibromo-N-methylbenzamide.
| Compound Name | N-(4-amino-4-sulfanylidenebutan-2-yl)-2,4-dibromo-N-methylbenzamide |
|---|---|
| PubChem CID | 114018352 |
| Molecular Formula | C12H14Br2N2OS |
| Molecular Weight | 394.13 g/mol |
| Exact Mass | 391.92 |
| IUPAC Name | N-(4-amino-4-sulfanylidenebutan-2-yl)-2,4-dibromo-N-methylbenzamide |
| SMILES | CC(CC(N)=S)N(C)C(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H14Br2N2OS/c1-7(5-11(15)18)16(2)12(17)9-4-3-8(13)6-10(9)14/h3-4,6-7H,5H2,1-2H3,(H2,15,18) |
| InChIKey | GMJNRMZFRAWQAW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.13 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|