C15H21Br2NO — CID 107951816
2,4-dibromo-N,N-bis(2-methylpropyl)benzamide (PubChem CID 107951816) has the molecular formula C15H21Br2NO and a molecular weight of 391.15 g/mol. Its IUPAC name is 2,4-dibromo-N,N-bis(2-methylpropyl)benzamide.
| Compound Name | 2,4-dibromo-N,N-bis(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 107951816 |
| Molecular Formula | C15H21Br2NO |
| Molecular Weight | 391.15 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | 2,4-dibromo-N,N-bis(2-methylpropyl)benzamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C15H21Br2NO/c1-10(2)8-18(9-11(3)4)15(19)13-6-5-12(16)7-14(13)17/h5-7,10-11H,8-9H2,1-4H3 |
| InChIKey | YSQYWAPMOKAUCA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.15 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |