C14H16Br2F3NO — CID 114371576
2,5-dibromo-N-pentan-3-yl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 114371576) has the molecular formula C14H16Br2F3NO and a molecular weight of 431.09 g/mol. Its IUPAC name is 2,5-dibromo-N-pentan-3-yl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2,5-dibromo-N-pentan-3-yl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 114371576 |
| Molecular Formula | C14H16Br2F3NO |
| Molecular Weight | 431.09 g/mol |
| Exact Mass | 428.96 |
| IUPAC Name | 2,5-dibromo-N-pentan-3-yl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CCC(CC)N(CC(F)(F)F)C(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C14H16Br2F3NO/c1-3-10(4-2)20(8-14(17,18)19)13(21)11-7-9(15)5-6-12(11)16/h5-7,10H,3-4,8H2,1-2H3 |
| InChIKey | MMPCWZJOEKXREG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.09 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |