C13H16BrCl2NO2 — CID 114263936
N-[2-(2-bromoethoxy)ethyl]-2,4-dichloro-N-ethylbenzamide (PubChem CID 114263936) has the molecular formula C13H16BrCl2NO2 and a molecular weight of 369.09 g/mol. Its IUPAC name is N-[2-(2-bromoethoxy)ethyl]-2,4-dichloro-N-ethylbenzamide.
| Compound Name | N-[2-(2-bromoethoxy)ethyl]-2,4-dichloro-N-ethylbenzamide |
|---|---|
| PubChem CID | 114263936 |
| Molecular Formula | C13H16BrCl2NO2 |
| Molecular Weight | 369.09 g/mol |
| Exact Mass | 366.97 |
| IUPAC Name | N-[2-(2-bromoethoxy)ethyl]-2,4-dichloro-N-ethylbenzamide |
| SMILES | CCN(CCOCCBr)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H16BrCl2NO2/c1-2-17(6-8-19-7-5-14)13(18)11-4-3-10(15)9-12(11)16/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | JCWYNPIYYIONND-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.09 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|