C13H16BrCl2NO — CID 107206177
N-(5-bromopentyl)-2,4-dichloro-N-methylbenzamide (PubChem CID 107206177) has the molecular formula C13H16BrCl2NO and a molecular weight of 353.09 g/mol. Its IUPAC name is N-(5-bromopentyl)-2,4-dichloro-N-methylbenzamide.
| Compound Name | N-(5-bromopentyl)-2,4-dichloro-N-methylbenzamide |
|---|---|
| PubChem CID | 107206177 |
| Molecular Formula | C13H16BrCl2NO |
| Molecular Weight | 353.09 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | N-(5-bromopentyl)-2,4-dichloro-N-methylbenzamide |
| SMILES | CN(CCCCCBr)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H16BrCl2NO/c1-17(8-4-2-3-7-14)13(18)11-6-5-10(15)9-12(11)16/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | YHQWLAANFIHFBJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.09 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|