C14H18Cl2N2O — CID 110753573
2,4-dichloro-N-methyl-N-(2-pyrrolidin-1-ylethyl)benzamide (PubChem CID 110753573) has the molecular formula C14H18Cl2N2O and a molecular weight of 301.22 g/mol. Its IUPAC name is 2,4-dichloro-N-methyl-N-(2-pyrrolidin-1-ylethyl)benzamide.
| Compound Name | 2,4-dichloro-N-methyl-N-(2-pyrrolidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 110753573 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2,4-dichloro-N-methyl-N-(2-pyrrolidin-1-ylethyl)benzamide |
| SMILES | CN(CCN1CCCC1)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H18Cl2N2O/c1-17(8-9-18-6-2-3-7-18)14(19)12-5-4-11(15)10-13(12)16/h4-5,10H,2-3,6-9H2,1H3 |
| InChIKey | QBJDCGSZKFXEQD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |