C18H28ClN3O3S — CID 56510508
2-chloro-N-methyl-5-[methyl(propan-2-yl)sulfamoyl]-N-(2-pyrrolidin-1-ylethyl)benzamide (PubChem CID 56510508) has the molecular formula C18H28ClN3O3S and a molecular weight of 401.96 g/mol. Its IUPAC name is 2-chloro-N-methyl-5-[methyl(propan-2-yl)sulfamoyl]-N-(2-pyrrolidin-1-ylethyl)benzamide.
| Compound Name | 2-chloro-N-methyl-5-[methyl(propan-2-yl)sulfamoyl]-N-(2-pyrrolidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 56510508 |
| Molecular Formula | C18H28ClN3O3S |
| Molecular Weight | 401.96 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 2-chloro-N-methyl-5-[methyl(propan-2-yl)sulfamoyl]-N-(2-pyrrolidin-1-ylethyl)benzamide |
| SMILES | CC(C)N(C)S(=O)(=O)c1ccc(Cl)c(C(=O)N(C)CCN2CCCC2)c1 |
| InChI | InChI=1S/C18H28ClN3O3S/c1-14(2)21(4)26(24,25)15-7-8-17(19)16(13-15)18(23)20(3)11-12-22-9-5-6-10-22/h7-8,13-14H,5-6,9-12H2,1-4H3 |
| InChIKey | BJQMEKOILAMFDW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.96 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |