C15H23ClN2O4S — CID 78855605
2-chloro-N-ethyl-N-(2-hydroxyethyl)-5-[methyl(propan-2-yl)sulfamoyl]benzamide (PubChem CID 78855605) has the molecular formula C15H23ClN2O4S and a molecular weight of 362.88 g/mol. Its IUPAC name is 2-chloro-N-ethyl-N-(2-hydroxyethyl)-5-[methyl(propan-2-yl)sulfamoyl]benzamide.
| Compound Name | 2-chloro-N-ethyl-N-(2-hydroxyethyl)-5-[methyl(propan-2-yl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 78855605 |
| Molecular Formula | C15H23ClN2O4S |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 2-chloro-N-ethyl-N-(2-hydroxyethyl)-5-[methyl(propan-2-yl)sulfamoyl]benzamide |
| SMILES | CCN(CCO)C(=O)c1cc(S(=O)(=O)N(C)C(C)C)ccc1Cl |
| InChI | InChI=1S/C15H23ClN2O4S/c1-5-18(8-9-19)15(20)13-10-12(6-7-14(13)16)23(21,22)17(4)11(2)3/h6-7,10-11,19H,5,8-9H2,1-4H3 |
| InChIKey | RIZLFTBDCSKRDL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |