C25H27ClN2O3S — CID 38071509
2-chloro-5-(dimethylsulfamoyl)-N,N-bis(2-phenylethyl)benzamide (PubChem CID 38071509) has the molecular formula C25H27ClN2O3S and a molecular weight of 471.02 g/mol. Its IUPAC name is 2-chloro-5-(dimethylsulfamoyl)-N,N-bis(2-phenylethyl)benzamide.
| Compound Name | 2-chloro-5-(dimethylsulfamoyl)-N,N-bis(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 38071509 |
| Molecular Formula | C25H27ClN2O3S |
| Molecular Weight | 471.02 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 2-chloro-5-(dimethylsulfamoyl)-N,N-bis(2-phenylethyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(Cl)c(C(=O)N(CCc2ccccc2)CCc2ccccc2)c1 |
| InChI | InChI=1S/C25H27ClN2O3S/c1-27(2)32(30,31)22-13-14-24(26)23(19-22)25(29)28(17-15-20-9-5-3-6-10-20)18-16-21-11-7-4-8-12-21/h3-14,19H,15-18H2,1-2H3 |
| InChIKey | GXVXAJQNXXNSPR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.02 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |