C18H22Cl2N2OS — CID 120886367
N-(2-aminoethyl)-2-chloro-5-methylsulfanyl-N-(2-phenylethyl)benzamide;hydrochloride (PubChem CID 120886367) has the molecular formula C18H22Cl2N2OS and a molecular weight of 385.36 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-chloro-5-methylsulfanyl-N-(2-phenylethyl)benzamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-2-chloro-5-methylsulfanyl-N-(2-phenylethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 120886367 |
| Molecular Formula | C18H22Cl2N2OS |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-(2-aminoethyl)-2-chloro-5-methylsulfanyl-N-(2-phenylethyl)benzamide;hydrochloride |
| SMILES | CSc1ccc(Cl)c(C(=O)N(CCN)CCc2ccccc2)c1.Cl |
| InChI | InChI=1S/C18H21ClN2OS.ClH/c1-23-15-7-8-17(19)16(13-15)18(22)21(12-10-20)11-9-14-5-3-2-4-6-14;/h2-8,13H,9-12,20H2,1H3;1H |
| InChIKey | XILIGCJYWQPYLW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |