C14H19ClN2O3S — CID 103802576
2-[(2-chloro-5-methylsulfanylbenzoyl)-[2-(dimethylamino)ethyl]amino]acetic acid (PubChem CID 103802576) has the molecular formula C14H19ClN2O3S and a molecular weight of 330.84 g/mol. Its IUPAC name is 2-[(2-chloro-5-methylsulfanylbenzoyl)-[2-(dimethylamino)ethyl]amino]acetic acid.
| Compound Name | 2-[(2-chloro-5-methylsulfanylbenzoyl)-[2-(dimethylamino)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 103802576 |
| Molecular Formula | C14H19ClN2O3S |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 2-[(2-chloro-5-methylsulfanylbenzoyl)-[2-(dimethylamino)ethyl]amino]acetic acid |
| SMILES | CSc1ccc(Cl)c(C(=O)N(CCN(C)C)CC(=O)O)c1 |
| InChI | InChI=1S/C14H19ClN2O3S/c1-16(2)6-7-17(9-13(18)19)14(20)11-8-10(21-3)4-5-12(11)15/h4-5,8H,6-7,9H2,1-3H3,(H,18,19) |
| InChIKey | LHMUSVFXLDBKAW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |