C13H16FIN2O3 — CID 103802814
2-[2-(dimethylamino)ethyl-(4-fluoro-2-iodobenzoyl)amino]acetic acid (PubChem CID 103802814) has the molecular formula C13H16FIN2O3 and a molecular weight of 394.18 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl-(4-fluoro-2-iodobenzoyl)amino]acetic acid.
| Compound Name | 2-[2-(dimethylamino)ethyl-(4-fluoro-2-iodobenzoyl)amino]acetic acid |
|---|---|
| PubChem CID | 103802814 |
| Molecular Formula | C13H16FIN2O3 |
| Molecular Weight | 394.18 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl-(4-fluoro-2-iodobenzoyl)amino]acetic acid |
| SMILES | CN(C)CCN(CC(=O)O)C(=O)c1ccc(F)cc1I |
| InChI | InChI=1S/C13H16FIN2O3/c1-16(2)5-6-17(8-12(18)19)13(20)10-4-3-9(14)7-11(10)15/h3-4,7H,5-6,8H2,1-2H3,(H,18,19) |
| InChIKey | JWGPDECXWSUEJO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.18 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|