C12H14FIN2O2 — CID 113222881
N-(2-amino-2-oxoethyl)-4-fluoro-2-iodo-N-propan-2-ylbenzamide (PubChem CID 113222881) has the molecular formula C12H14FIN2O2 and a molecular weight of 364.16 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-fluoro-2-iodo-N-propan-2-ylbenzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-fluoro-2-iodo-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 113222881 |
| Molecular Formula | C12H14FIN2O2 |
| Molecular Weight | 364.16 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-fluoro-2-iodo-N-propan-2-ylbenzamide |
| SMILES | CC(C)N(CC(N)=O)C(=O)c1ccc(F)cc1I |
| InChI | InChI=1S/C12H14FIN2O2/c1-7(2)16(6-11(15)17)12(18)9-4-3-8(13)5-10(9)14/h3-5,7H,6H2,1-2H3,(H2,15,17) |
| InChIKey | JOOMTQNJHMOBCB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.16 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|