C13H18FIN2O — CID 113265912
N-(3-amino-2,2-dimethylpropyl)-4-fluoro-2-iodo-N-methylbenzamide (PubChem CID 113265912) has the molecular formula C13H18FIN2O and a molecular weight of 364.20 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-4-fluoro-2-iodo-N-methylbenzamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-4-fluoro-2-iodo-N-methylbenzamide |
|---|---|
| PubChem CID | 113265912 |
| Molecular Formula | C13H18FIN2O |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-4-fluoro-2-iodo-N-methylbenzamide |
| SMILES | CN(CC(C)(C)CN)C(=O)c1ccc(F)cc1I |
| InChI | InChI=1S/C13H18FIN2O/c1-13(2,7-16)8-17(3)12(18)10-5-4-9(14)6-11(10)15/h4-6H,7-8,16H2,1-3H3 |
| InChIKey | AZHVPACDILIRPB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|