C13H17FINO — CID 106547719
N-(2,2-dimethylbutyl)-4-fluoro-2-iodobenzamide (PubChem CID 106547719) has the molecular formula C13H17FINO and a molecular weight of 349.19 g/mol. Its IUPAC name is N-(2,2-dimethylbutyl)-4-fluoro-2-iodobenzamide.
| Compound Name | N-(2,2-dimethylbutyl)-4-fluoro-2-iodobenzamide |
|---|---|
| PubChem CID | 106547719 |
| Molecular Formula | C13H17FINO |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-(2,2-dimethylbutyl)-4-fluoro-2-iodobenzamide |
| SMILES | CCC(C)(C)CNC(=O)c1ccc(F)cc1I |
| InChI | InChI=1S/C13H17FINO/c1-4-13(2,3)8-16-12(17)10-6-5-9(14)7-11(10)15/h5-7H,4,8H2,1-3H3,(H,16,17) |
| InChIKey | IIXTYWGREYQETQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|