C10H9FINO3 — CID 115596361
3-[(4-fluoro-2-iodobenzoyl)amino]propanoic acid (PubChem CID 115596361) has the molecular formula C10H9FINO3 and a molecular weight of 337.09 g/mol. Its IUPAC name is 3-[(4-fluoro-2-iodobenzoyl)amino]propanoic acid.
| Compound Name | 3-[(4-fluoro-2-iodobenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 115596361 |
| Molecular Formula | C10H9FINO3 |
| Molecular Weight | 337.09 g/mol |
| Exact Mass | 336.96 |
| IUPAC Name | 3-[(4-fluoro-2-iodobenzoyl)amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccc(F)cc1I |
| InChI | InChI=1S/C10H9FINO3/c11-6-1-2-7(8(12)5-6)10(16)13-4-3-9(14)15/h1-2,5H,3-4H2,(H,13,16)(H,14,15) |
| InChIKey | WAIVUVBPCJCOSD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.09 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|